C10H14O5 — CID 102350593
(1S,5R)-5-acetyloxy-1-hydroxy-4-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 102350593) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1S,5R)-5-acetyloxy-1-hydroxy-4-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,5R)-5-acetyloxy-1-hydroxy-4-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 102350593 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1S,5R)-5-acetyloxy-1-hydroxy-4-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1C[C@](O)(C(=O)O)CC=C1C |
| InChI | InChI=1S/C10H14O5/c1-6-3-4-10(14,9(12)13)5-8(6)15-7(2)11/h3,8,14H,4-5H2,1-2H3,(H,12,13)/t8-,10+/m1/s1 |
| InChIKey | MDSQCZKLZODNEI-SCZZXKLOSA-N |
| XLogP | 0.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|