C10H16O4 — CID 141081154
methyl 1,5-dihydroxy-2,5-dimethylcyclohex-2-ene-1-carboxylate (PubChem CID 141081154) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 1,5-dihydroxy-2,5-dimethylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 1,5-dihydroxy-2,5-dimethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 141081154 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 1,5-dihydroxy-2,5-dimethylcyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(O)CC(C)(O)CC=C1C |
| InChI | InChI=1S/C10H16O4/c1-7-4-5-9(2,12)6-10(7,13)8(11)14-3/h4,12-13H,5-6H2,1-3H3 |
| InChIKey | TWKDEWCRWSVGSM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|