C18H21NO5 — CID 102351901
methyl 2-[(4-hydroxy-5,5-dimethyl-2-oxo-1H-pyrrol-3-yl)-phenylmethyl]-3-oxobutanoate (PubChem CID 102351901) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 2-[(4-hydroxy-5,5-dimethyl-2-oxo-1H-pyrrol-3-yl)-phenylmethyl]-3-oxobutanoate.
| Compound Name | methyl 2-[(4-hydroxy-5,5-dimethyl-2-oxo-1H-pyrrol-3-yl)-phenylmethyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 102351901 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 2-[(4-hydroxy-5,5-dimethyl-2-oxo-1H-pyrrol-3-yl)-phenylmethyl]-3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)C(C1=C(O)C(C)(C)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO5/c1-10(20)12(17(23)24-4)13(11-8-6-5-7-9-11)14-15(21)18(2,3)19-16(14)22/h5-9,12-13,21H,1-4H3,(H,19,22) |
| InChIKey | BNUDCIOGZLTAPP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|