C14H22FNO4 — CID 102352689
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-fluoro-2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 102352689) has the molecular formula C14H22FNO4 and a molecular weight of 287.33 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-fluoro-2-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-fluoro-2-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102352689 |
| Molecular Formula | C14H22FNO4 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-fluoro-2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)N1C(=O)OCC1F |
| InChI | InChI=1S/C14H22FNO4/c1-8(2)10-5-4-9(3)6-11(10)20-14(18)16-12(15)7-19-13(16)17/h8-12H,4-7H2,1-3H3/t9-,10+,11-,12?/m1/s1 |
| InChIKey | LTQFIIDLMWSBEF-FBTJUVTCSA-N |
| XLogP | 3.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|