C15H27NO2 — CID 142844210
[(2S)-5-methyl-2-propan-2-ylcyclohexyl] pyrrolidine-1-carboxylate (PubChem CID 142844210) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(2S)-5-methyl-2-propan-2-ylcyclohexyl] pyrrolidine-1-carboxylate.
| Compound Name | [(2S)-5-methyl-2-propan-2-ylcyclohexyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142844210 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(2S)-5-methyl-2-propan-2-ylcyclohexyl] pyrrolidine-1-carboxylate |
| SMILES | CC1CC[C@@H](C(C)C)C(OC(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C15H27NO2/c1-11(2)13-7-6-12(3)10-14(13)18-15(17)16-8-4-5-9-16/h11-14H,4-10H2,1-3H3/t12?,13-,14?/m0/s1 |
| InChIKey | RCKGVDDTPDZBFZ-MOKVOYLWSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |