C36H40N10O13S2 — CID 102353097
2-[[4-[methyl-[6-oxo-6-[5-(2,4,6-trinitroanilino)pentylamino]hexyl]amino]phenyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 102353097) has the molecular formula C36H40N10O13S2 and a molecular weight of 884.91 g/mol. Its IUPAC name is 2-[[4-[methyl-[6-oxo-6-[5-(2,4,6-trinitroanilino)pentylamino]hexyl]amino]phenyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[methyl-[6-oxo-6-[5-(2,4,6-trinitroanilino)pentylamino]hexyl]amino]phenyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102353097 |
| Molecular Formula | C36H40N10O13S2 |
| Molecular Weight | 884.91 g/mol |
| Exact Mass | 884.22 |
| IUPAC Name | 2-[[4-[methyl-[6-oxo-6-[5-(2,4,6-trinitroanilino)pentylamino]hexyl]amino]phenyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | CN(CCCCCC(=O)NCCCCCNc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C36H40N10O13S2/c1-43(21-7-2-4-8-35(47)37-19-5-3-6-20-38-36-32(45(50)51)23-29(44(48)49)24-33(36)46(52)53)28-14-9-25(10-15-28)40-42-31-18-13-27(22-34(31)61(57,58)59)41-39-26-11-16-30(17-12-26)60(54,55)56/h9-18,22-24,38H,2-8,19-21H2,1H3,(H,37,47)(H,54,55,56)(H,57,58,59)/b41-39+,42-40+ |
| InChIKey | TYCQJCWLISIUSL-LMXNTIJMSA-N |
| XLogP | 8.13 |
| TPSA | 331.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.91 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|