C44H50N4O8 — CID 102353302
[(3R,3aR,6R,6aR)-6-[3-[(4-hexoxyphenyl)diazenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-[(4-hexoxyphenyl)diazenyl]benzoate (PubChem CID 102353302) has the molecular formula C44H50N4O8 and a molecular weight of 762.90 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-[3-[(4-hexoxyphenyl)diazenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-[(4-hexoxyphenyl)diazenyl]benzoate.
| Compound Name | [(3R,3aR,6R,6aR)-6-[3-[(4-hexoxyphenyl)diazenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-[(4-hexoxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 102353302 |
| Molecular Formula | C44H50N4O8 |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.36 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-[3-[(4-hexoxyphenyl)diazenyl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-[(4-hexoxyphenyl)diazenyl]benzoate |
| SMILES | CCCCCCOc1ccc(/N=N/c2cccc(C(=O)O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4OC(=O)c3cccc(/N=N/c4ccc(OCCCCCC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C44H50N4O8/c1-3-5-7-9-25-51-37-21-17-33(18-22-37)45-47-35-15-11-13-31(27-35)43(49)55-39-29-53-42-40(30-54-41(39)42)56-44(50)32-14-12-16-36(28-32)48-46-34-19-23-38(24-20-34)52-26-10-8-6-4-2/h11-24,27-28,39-42H,3-10,25-26,29-30H2,1-2H3/b47-45+,48-46+/t39-,40-,41-,42-/m1/s1 |
| InChIKey | OOAJOJSVBMIIMG-HMBJRSFNSA-N |
| XLogP | 10.98 |
| TPSA | 138.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|