C16H31NO3S — CID 102353435
[(5R,6S,7S,8S,8aS)-6,8-diethyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] methanesulfonate (PubChem CID 102353435) has the molecular formula C16H31NO3S and a molecular weight of 317.50 g/mol. Its IUPAC name is [(5R,6S,7S,8S,8aS)-6,8-diethyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] methanesulfonate.
| Compound Name | [(5R,6S,7S,8S,8aS)-6,8-diethyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 102353435 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(5R,6S,7S,8S,8aS)-6,8-diethyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] methanesulfonate |
| SMILES | CCC[C@@H]1[C@H](CC)[C@H](OS(C)(=O)=O)[C@@H](CC)[C@@H]2CCCN12 |
| InChI | InChI=1S/C16H31NO3S/c1-5-9-14-12(6-2)16(20-21(4,18)19)13(7-3)15-10-8-11-17(14)15/h12-16H,5-11H2,1-4H3/t12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | JFKTVNSLBLYCAL-QMHWVQJVSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|