C8H13NO3S — CID 99989963
(5R,6R)-6-ethylsulfonyl-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 99989963) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is (5R,6R)-6-ethylsulfonyl-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R,6R)-6-ethylsulfonyl-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 99989963 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (5R,6R)-6-ethylsulfonyl-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CCS(=O)(=O)[C@H]1C(=O)N2CCC[C@H]12 |
| InChI | InChI=1S/C8H13NO3S/c1-2-13(11,12)7-6-4-3-5-9(6)8(7)10/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | UWARWQQYNGXMQY-RNFRBKRXSA-N |
| XLogP | -0.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |