C7H12N2O — CID 176916786
(1S,7aS)-1-methyl-1,2,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-3-one (PubChem CID 176916786) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (1S,7aS)-1-methyl-1,2,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-3-one.
| Compound Name | (1S,7aS)-1-methyl-1,2,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-3-one |
|---|---|
| PubChem CID | 176916786 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (1S,7aS)-1-methyl-1,2,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-3-one |
| SMILES | C[C@@H]1NC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C7H12N2O/c1-5-6-3-2-4-9(6)7(10)8-5/h5-6H,2-4H2,1H3,(H,8,10)/t5-,6-/m0/s1 |
| InChIKey | UWOBUEYJXYWPPX-WDSKDSINSA-N |
| XLogP | 0.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |