C9H15NO — CID 127256799
(8S,8aR)-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 127256799) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is (8S,8aR)-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (8S,8aR)-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 127256799 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (8S,8aR)-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@H]1CCCN2C(=O)CC[C@H]12 |
| InChI | InChI=1S/C9H15NO/c1-7-3-2-6-10-8(7)4-5-9(10)11/h7-8H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | UIPIFRBRNRAGAX-JGVFFNPUSA-N |
| XLogP | 1.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |