C12H15ClO6 — CID 102355480
[(1R,4R,5R,6R)-5,6-diacetyloxy-4-chlorocyclohex-2-en-1-yl] acetate (PubChem CID 102355480) has the molecular formula C12H15ClO6 and a molecular weight of 290.70 g/mol. Its IUPAC name is [(1R,4R,5R,6R)-5,6-diacetyloxy-4-chlorocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4R,5R,6R)-5,6-diacetyloxy-4-chlorocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 102355480 |
| Molecular Formula | C12H15ClO6 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [(1R,4R,5R,6R)-5,6-diacetyloxy-4-chlorocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)C=C[C@H]1Cl |
| InChI | InChI=1S/C12H15ClO6/c1-6(14)17-10-5-4-9(13)11(18-7(2)15)12(10)19-8(3)16/h4-5,9-12H,1-3H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | QNFYLQWQMWIPMS-WISYIIOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|