C19H23NO3 — CID 102356288
4-acetyl-1-cyclohexyl-5-hydroxy-5-methyl-3-phenylpyrrol-2-one (PubChem CID 102356288) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-acetyl-1-cyclohexyl-5-hydroxy-5-methyl-3-phenylpyrrol-2-one.
| Compound Name | 4-acetyl-1-cyclohexyl-5-hydroxy-5-methyl-3-phenylpyrrol-2-one |
|---|---|
| PubChem CID | 102356288 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-acetyl-1-cyclohexyl-5-hydroxy-5-methyl-3-phenylpyrrol-2-one |
| SMILES | CC(=O)C1=C(c2ccccc2)C(=O)N(C2CCCCC2)C1(C)O |
| InChI | InChI=1S/C19H23NO3/c1-13(21)17-16(14-9-5-3-6-10-14)18(22)20(19(17,2)23)15-11-7-4-8-12-15/h3,5-6,9-10,15,23H,4,7-8,11-12H2,1-2H3 |
| InChIKey | QQAJASVNJBZIKL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |