C11H5BrF10O — CID 102356395
3-(2-bromophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-ol (PubChem CID 102356395) has the molecular formula C11H5BrF10O and a molecular weight of 423.04 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-ol.
| Compound Name | 3-(2-bromophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-ol |
|---|---|
| PubChem CID | 102356395 |
| Molecular Formula | C11H5BrF10O |
| Molecular Weight | 423.04 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 3-(2-bromophenyl)-1,1,1,2,2,4,4,5,5,5-decafluoropentan-3-ol |
| SMILES | OC(c1ccccc1Br)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5BrF10O/c12-6-4-2-1-3-5(6)7(23,8(13,14)10(17,18)19)9(15,16)11(20,21)22/h1-4,23H |
| InChIKey | XIDVVUARBVQZTB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.04 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|