About CID 102357145
CID 102357145 (PubChem CID 102357145) has the molecular formula C7H7N2
and a molecular weight of 119.15 g/mol.
Molecular Properties
| Compound Name | CID 102357145 |
| PubChem CID | 102357145 |
| Molecular Formula | C7H7N2 |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | — |
| SMILES | CN=C1C=CC(=[N])C=C1 |
| InChI | InChI=1S/C7H7N2/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | GXWIHWUEAXGJMD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 34.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 102357145 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102357145?
The IUPAC name of CID 102357145 (CID 102357145) is not available.
What is the SMILES notation for CID 102357145?
The canonical SMILES for CID 102357145 is CN=C1C=CC(=[N])C=C1.
What is the InChIKey of CID 102357145?
The InChIKey is GXWIHWUEAXGJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3.
What are the key properties of CID 102357145?
CID 102357145 has a molecular weight of 119.15 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102357145 is sourced from PubChem (CID 102357145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).