C25H24F2N2O4 — CID 1023582
(4R)-N-(2,6-difluorophenyl)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 1023582) has the molecular formula C25H24F2N2O4 and a molecular weight of 454.47 g/mol. Its IUPAC name is (4R)-N-(2,6-difluorophenyl)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | (4R)-N-(2,6-difluorophenyl)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 1023582 |
| Molecular Formula | C25H24F2N2O4 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (4R)-N-(2,6-difluorophenyl)-4-(2,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc([C@H]2C(C(=O)Nc3c(F)cccc3F)=C(C)NC3=C2C(=O)CCC3)c(OC)c1 |
| InChI | InChI=1S/C25H24F2N2O4/c1-13-21(25(31)29-24-16(26)6-4-7-17(24)27)22(23-18(28-13)8-5-9-19(23)30)15-11-10-14(32-2)12-20(15)33-3/h4,6-7,10-12,22,28H,5,8-9H2,1-3H3,(H,29,31)/t22-/m0/s1 |
| InChIKey | SDNJRJRXSULPNN-QFIPXVFZSA-N |
| XLogP | 4.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |