C24H20F2N2O4 — CID 23945058
4-(1,3-benzodioxol-5-yl)-N-(2,6-difluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 23945058) has the molecular formula C24H20F2N2O4 and a molecular weight of 438.43 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(2,6-difluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(2,6-difluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 23945058 |
| Molecular Formula | C24H20F2N2O4 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(2,6-difluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2c(F)cccc2F)C(c2ccc3c(c2)OCO3)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C24H20F2N2O4/c1-12-20(24(30)28-23-14(25)4-2-5-15(23)26)21(22-16(27-12)6-3-7-17(22)29)13-8-9-18-19(10-13)32-11-31-18/h2,4-5,8-10,21,27H,3,6-7,11H2,1H3,(H,28,30) |
| InChIKey | OXVGERAWYBPODZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |