About 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline
8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline (PubChem CID 102359192) has the molecular formula C26H23NO2
and a molecular weight of 381.48 g/mol. Its IUPAC name is 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline.
Molecular Properties
| Compound Name | 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline |
| PubChem CID | 102359192 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline |
| SMILES | COc1ccc(/C=C(/Cc2cccc3cccnc23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H23NO2/c1-28-24-12-8-19(9-13-24)17-23(20-10-14-25(29-2)15-11-20)18-22-6-3-5-21-7-4-16-27-26(21)22/h3-17H,18H2,1-2H3/b23-17- |
| InChIKey | SHPZNQQKRDEQDC-QJOMJCCJSA-N |
| XLogP | 6.04 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline?
The IUPAC name of 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline (CID 102359192) is 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline.
What is the SMILES notation for 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline?
The canonical SMILES for 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline is COc1ccc(/C=C(/Cc2cccc3cccnc23)c2ccc(OC)cc2)cc1.
What is the InChIKey of 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline?
The InChIKey is SHPZNQQKRDEQDC-QJOMJCCJSA-N. The full InChI is InChI=1S/C26H23NO2/c1-28-24-12-8-19(9-13-24)17-23(20-10-14-25(29-2)15-11-20)18-22-6-3-5-21-7-4-16-27-26(21)22/h3-17H,18H2,1-2H3/b23-17-.
What are the key properties of 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline?
8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline has a molecular weight of 381.48 g/mol, XLogP of 6.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(Z)-2,3-bis(4-methoxyphenyl)prop-2-enyl]quinoline is sourced from PubChem (CID 102359192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).