C24H25N3O5 — CID 102360412
(2S,3R)-2-amino-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methyl-3-(4-nitrophenyl)propanamide (PubChem CID 102360412) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methyl-3-(4-nitrophenyl)propanamide.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methyl-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 102360412 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N-methyl-3-(4-nitrophenyl)propanamide |
| SMILES | CN(C(=O)[C@@H](N)[C@H](O)c1ccc([N+](=O)[O-])cc1)[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O5/c1-26(24(30)20(25)22(28)18-12-14-19(15-13-18)27(31)32)21(16-8-4-2-5-9-16)23(29)17-10-6-3-7-11-17/h2-15,20-23,28-29H,25H2,1H3/t20-,21+,22+,23+/m0/s1 |
| InChIKey | WTXIYUXYWAKWBV-WBADGQHESA-N |
| XLogP | 2.89 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|