C14H26O3Si — CID 102360606
ethyl (E,3R)-3-methyl-2-oxo-8-trimethylsilyloct-6-enoate (PubChem CID 102360606) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is ethyl (E,3R)-3-methyl-2-oxo-8-trimethylsilyloct-6-enoate.
| Compound Name | ethyl (E,3R)-3-methyl-2-oxo-8-trimethylsilyloct-6-enoate |
|---|---|
| PubChem CID | 102360606 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | ethyl (E,3R)-3-methyl-2-oxo-8-trimethylsilyloct-6-enoate |
| SMILES | CCOC(=O)C(=O)[C@H](C)CC/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-6-17-14(16)13(15)12(2)10-8-7-9-11-18(3,4)5/h7,9,12H,6,8,10-11H2,1-5H3/b9-7+/t12-/m1/s1 |
| InChIKey | BHOQMXJXRUCZKS-YPUOHESYSA-N |
| XLogP | 3.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|