C22H27NO6 — CID 102360722
tert-butyl (3R,3aR,6aS)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3-prop-2-enyl-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate (PubChem CID 102360722) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6aS)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3-prop-2-enyl-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6aS)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3-prop-2-enyl-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 102360722 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl (3R,3aR,6aS)-1-[(4-methoxyphenyl)methyl]-2,6-dioxo-3-prop-2-enyl-3a,4-dihydro-3H-furo[3,4-b]pyrrole-6a-carboxylate |
| SMILES | C=CC[C@H]1C(=O)N(Cc2ccc(OC)cc2)[C@]2(C(=O)OC(C)(C)C)C(=O)OC[C@H]12 |
| InChI | InChI=1S/C22H27NO6/c1-6-7-16-17-13-28-19(25)22(17,20(26)29-21(2,3)4)23(18(16)24)12-14-8-10-15(27-5)11-9-14/h6,8-11,16-17H,1,7,12-13H2,2-5H3/t16-,17-,22+/m1/s1 |
| InChIKey | VSXQFKSIPCBRFW-YVHKJVDXSA-N |
| XLogP | 2.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|