C19H27NO6 — CID 118496428
tert-butyl 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-3-oxomorpholin-2-yl]propanoate (PubChem CID 118496428) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-3-oxomorpholin-2-yl]propanoate.
| Compound Name | tert-butyl 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-3-oxomorpholin-2-yl]propanoate |
|---|---|
| PubChem CID | 118496428 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | tert-butyl 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-3-oxomorpholin-2-yl]propanoate |
| SMILES | COc1ccc(CN2CCO[C@H](C(C)(O)C(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C19H27NO6/c1-18(2,3)26-17(22)19(4,23)15-16(21)20(10-11-25-15)12-13-6-8-14(24-5)9-7-13/h6-9,15,23H,10-12H2,1-5H3/t15-,19?/m0/s1 |
| InChIKey | ZMLRBEXXZRGBQC-FUKCDUGKSA-N |
| XLogP | 1.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |