C19H18Cl2INO3 — CID 170961087
2-[(2,4-dichloro-6-iodophenyl)methyl]-4-[(4-methoxyphenyl)methyl]morpholin-3-one (PubChem CID 170961087) has the molecular formula C19H18Cl2INO3 and a molecular weight of 506.17 g/mol. Its IUPAC name is 2-[(2,4-dichloro-6-iodophenyl)methyl]-4-[(4-methoxyphenyl)methyl]morpholin-3-one.
| Compound Name | 2-[(2,4-dichloro-6-iodophenyl)methyl]-4-[(4-methoxyphenyl)methyl]morpholin-3-one |
|---|---|
| PubChem CID | 170961087 |
| Molecular Formula | C19H18Cl2INO3 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 504.97 |
| IUPAC Name | 2-[(2,4-dichloro-6-iodophenyl)methyl]-4-[(4-methoxyphenyl)methyl]morpholin-3-one |
| SMILES | COc1ccc(CN2CCOC(Cc3c(Cl)cc(Cl)cc3I)C2=O)cc1 |
| InChI | InChI=1S/C19H18Cl2INO3/c1-25-14-4-2-12(3-5-14)11-23-6-7-26-18(19(23)24)10-15-16(21)8-13(20)9-17(15)22/h2-5,8-9,18H,6-7,10-11H2,1H3 |
| InChIKey | RPPQANJISYTYDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|