C16H21NO6 — CID 90319948
2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxomorpholin-2-yl]propanoic acid (PubChem CID 90319948) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxomorpholin-2-yl]propanoic acid.
| Compound Name | 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxomorpholin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90319948 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-hydroxy-2-[(2R)-4-[(4-methoxyphenyl)methyl]-2-methyl-3-oxomorpholin-2-yl]propanoic acid |
| SMILES | COc1ccc(CN2CCO[C@](C)(C(C)(O)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C16H21NO6/c1-15(21,14(19)20)16(2)13(18)17(8-9-23-16)10-11-4-6-12(22-3)7-5-11/h4-7,21H,8-10H2,1-3H3,(H,19,20)/t15?,16-/m0/s1 |
| InChIKey | AZHZSVSMWUNITE-LYKKTTPLSA-N |
| XLogP | 0.65 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |