C26H35NO6 — CID 102360723
ditert-butyl (3aR,7aR)-2-[(4-methoxyphenyl)methyl]-3-oxo-3a,4,7,7a-tetrahydroisoindole-1,1-dicarboxylate (PubChem CID 102360723) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is ditert-butyl (3aR,7aR)-2-[(4-methoxyphenyl)methyl]-3-oxo-3a,4,7,7a-tetrahydroisoindole-1,1-dicarboxylate.
| Compound Name | ditert-butyl (3aR,7aR)-2-[(4-methoxyphenyl)methyl]-3-oxo-3a,4,7,7a-tetrahydroisoindole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102360723 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | ditert-butyl (3aR,7aR)-2-[(4-methoxyphenyl)methyl]-3-oxo-3a,4,7,7a-tetrahydroisoindole-1,1-dicarboxylate |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3CC=CC[C@H]3C2(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35NO6/c1-24(2,3)32-22(29)26(23(30)33-25(4,5)6)20-11-9-8-10-19(20)21(28)27(26)16-17-12-14-18(31-7)15-13-17/h8-9,12-15,19-20H,10-11,16H2,1-7H3/t19-,20-/m1/s1 |
| InChIKey | APSVWXFUCRDPDY-WOJBJXKFSA-N |
| XLogP | 4.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|