C19H22F3NO7S — CID 11705378
[(1S,4R,7R,8R)-5-[(4-methoxyphenyl)methyl]-7-methyl-3,6-dioxo-1-propan-2-yl-2-oxa-5-azaspiro[3.4]octan-8-yl] trifluoromethanesulfonate (PubChem CID 11705378) has the molecular formula C19H22F3NO7S and a molecular weight of 465.45 g/mol. Its IUPAC name is [(1S,4R,7R,8R)-5-[(4-methoxyphenyl)methyl]-7-methyl-3,6-dioxo-1-propan-2-yl-2-oxa-5-azaspiro[3.4]octan-8-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,4R,7R,8R)-5-[(4-methoxyphenyl)methyl]-7-methyl-3,6-dioxo-1-propan-2-yl-2-oxa-5-azaspiro[3.4]octan-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11705378 |
| Molecular Formula | C19H22F3NO7S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [(1S,4R,7R,8R)-5-[(4-methoxyphenyl)methyl]-7-methyl-3,6-dioxo-1-propan-2-yl-2-oxa-5-azaspiro[3.4]octan-8-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CN2C(=O)[C@H](C)[C@@H](OS(=O)(=O)C(F)(F)F)[C@]23C(=O)O[C@H]3C(C)C)cc1 |
| InChI | InChI=1S/C19H22F3NO7S/c1-10(2)14-18(17(25)29-14)15(30-31(26,27)19(20,21)22)11(3)16(24)23(18)9-12-5-7-13(28-4)8-6-12/h5-8,10-11,14-15H,9H2,1-4H3/t11-,14+,15-,18-/m1/s1 |
| InChIKey | YFOBBCZBADVWKG-DQADVMEASA-N |
| XLogP | 2.23 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|