C21H25NO8 — CID 25053736
dimethyl (4R)-4-(2-acetyloxyethyl)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 25053736) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is dimethyl (4R)-4-(2-acetyloxyethyl)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | dimethyl (4R)-4-(2-acetyloxyethyl)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 25053736 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | dimethyl (4R)-4-(2-acetyloxyethyl)-1-[(4-methoxyphenyl)methyl]-3-methylidene-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | C=C1[C@@H](CCOC(C)=O)C(=O)N(Cc2ccc(OC)cc2)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H25NO8/c1-13-17(10-11-30-14(2)23)18(24)22(12-15-6-8-16(27-3)9-7-15)21(13,19(25)28-4)20(26)29-5/h6-9,17H,1,10-12H2,2-5H3/t17-/m1/s1 |
| InChIKey | AJXKTBQPKPBJEA-QGZVFWFLSA-N |
| XLogP | 1.25 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|