C17H22N2O3 — CID 102360791
(3aS,4S,7R,7aR)-5-benzyl-7-hydroxy-2,2,3a-trimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-4-carbonitrile (PubChem CID 102360791) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-5-benzyl-7-hydroxy-2,2,3a-trimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-4-carbonitrile.
| Compound Name | (3aS,4S,7R,7aR)-5-benzyl-7-hydroxy-2,2,3a-trimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 102360791 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (3aS,4S,7R,7aR)-5-benzyl-7-hydroxy-2,2,3a-trimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyridine-4-carbonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O)CN(Cc3ccccc3)[C@@H](C#N)[C@]2(C)O1 |
| InChI | InChI=1S/C17H22N2O3/c1-16(2)21-15-13(20)11-19(10-12-7-5-4-6-8-12)14(9-18)17(15,3)22-16/h4-8,13-15,20H,10-11H2,1-3H3/t13-,14+,15-,17+/m1/s1 |
| InChIKey | UIFNZNCFIPMUGU-DLTWYDFYSA-N |
| XLogP | 1.67 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |