C14H16N2O4 — CID 10683845
(3R,5R,6R,7S,8R,8aR)-6,7,8-trihydroxy-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile (PubChem CID 10683845) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (3R,5R,6R,7S,8R,8aR)-6,7,8-trihydroxy-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile.
| Compound Name | (3R,5R,6R,7S,8R,8aR)-6,7,8-trihydroxy-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 10683845 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3R,5R,6R,7S,8R,8aR)-6,7,8-trihydroxy-3-phenyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C14H16N2O4/c15-6-9-11(17)12(18)13(19)14-16(9)10(7-20-14)8-4-2-1-3-5-8/h1-5,9-14,17-19H,7H2/t9-,10+,11-,12+,13-,14-/m1/s1 |
| InChIKey | KZKYYQIKNYLFOD-QQOHENMQSA-N |
| XLogP | -0.63 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |