C15H15N3O — CID 10800865
(3R,8aR)-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,5-dicarbonitrile (PubChem CID 10800865) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is (3R,8aR)-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,5-dicarbonitrile.
| Compound Name | (3R,8aR)-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,5-dicarbonitrile |
|---|---|
| PubChem CID | 10800865 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (3R,8aR)-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,5-dicarbonitrile |
| SMILES | N#CC1(C#N)CCC[C@H]2OC[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C15H15N3O/c16-10-15(11-17)8-4-7-14-18(15)13(9-19-14)12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-9H2/t13-,14+/m0/s1 |
| InChIKey | JNOFKCIQDZKXQL-UONOGXRCSA-N |
| XLogP | 2.36 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |