C14H17NOS — CID 10966836
(3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-thione (PubChem CID 10966836) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is (3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-thione.
| Compound Name | (3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-thione |
|---|---|
| PubChem CID | 10966836 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine-5-thione |
| SMILES | C[C@@]12CCCC(=S)N1[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C14H17NOS/c1-14-9-5-8-13(17)15(14)12(10-16-14)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | REQNNORUYJQMJL-TZMCWYRMSA-N |
| XLogP | 3.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|