C17H22N2O2 — CID 134841345
(3R,5S,8aR)-5-[(1R)-1-hydroxypropyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile (PubChem CID 134841345) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3R,5S,8aR)-5-[(1R)-1-hydroxypropyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile.
| Compound Name | (3R,5S,8aR)-5-[(1R)-1-hydroxypropyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 134841345 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3R,5S,8aR)-5-[(1R)-1-hydroxypropyl]-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5-carbonitrile |
| SMILES | CC[C@@H](O)[C@@]1(C#N)CCC[C@H]2OC[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C17H22N2O2/c1-2-15(20)17(12-18)10-6-9-16-19(17)14(11-21-16)13-7-4-3-5-8-13/h3-5,7-8,14-16,20H,2,6,9-11H2,1H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | OPOFYFBMNGPTKY-HZMVEIRTSA-N |
| XLogP | 2.60 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |