C35H32ClNO7 — CID 102360805
(2R,4aR,5S,8aR)-5-[(Z)-2-(4-carboxyphenyl)-2-chloroethenyl]-7-methyl-2-[2-(4-pyridin-3-yloxybenzoyl)oxyethyl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid (PubChem CID 102360805) has the molecular formula C35H32ClNO7 and a molecular weight of 614.09 g/mol. Its IUPAC name is (2R,4aR,5S,8aR)-5-[(Z)-2-(4-carboxyphenyl)-2-chloroethenyl]-7-methyl-2-[2-(4-pyridin-3-yloxybenzoyl)oxyethyl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid.
| Compound Name | (2R,4aR,5S,8aR)-5-[(Z)-2-(4-carboxyphenyl)-2-chloroethenyl]-7-methyl-2-[2-(4-pyridin-3-yloxybenzoyl)oxyethyl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid |
|---|---|
| PubChem CID | 102360805 |
| Molecular Formula | C35H32ClNO7 |
| Molecular Weight | 614.09 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | (2R,4aR,5S,8aR)-5-[(Z)-2-(4-carboxyphenyl)-2-chloroethenyl]-7-methyl-2-[2-(4-pyridin-3-yloxybenzoyl)oxyethyl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid |
| SMILES | CC1=C[C@@H](/C=C(\Cl)c2ccc(C(=O)O)cc2)[C@]2(C(=O)O)C=C[C@@H](CCOC(=O)c3ccc(Oc4cccnc4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C35H32ClNO7/c1-22-17-27-19-23(13-16-43-33(40)26-8-10-29(11-9-26)44-30-3-2-15-37-21-30)12-14-35(27,34(41)42)28(18-22)20-31(36)24-4-6-25(7-5-24)32(38)39/h2-12,14-15,18,20-21,23,27-28H,13,16-17,19H2,1H3,(H,38,39)(H,41,42)/b31-20-/t23-,27-,28-,35-/m0/s1 |
| InChIKey | ISVVPPOKPVDMHF-LWEQDFGKSA-N |
| XLogP | 7.63 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.09 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|