C18H26O5S — CID 102361774
ethyl (3S)-2,4-dimethyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]pent-4-enoate (PubChem CID 102361774) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is ethyl (3S)-2,4-dimethyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]pent-4-enoate.
| Compound Name | ethyl (3S)-2,4-dimethyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]pent-4-enoate |
|---|---|
| PubChem CID | 102361774 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethyl (3S)-2,4-dimethyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]pent-4-enoate |
| SMILES | C=C(C)[C@@H](CCOS(=O)(=O)c1ccc(C)cc1)C(C)C(=O)OCC |
| InChI | InChI=1S/C18H26O5S/c1-6-22-18(19)15(5)17(13(2)3)11-12-23-24(20,21)16-9-7-14(4)8-10-16/h7-10,15,17H,2,6,11-12H2,1,3-5H3/t15?,17-/m1/s1 |
| InChIKey | PYFNHMPRJAIBHS-OMOCHNIRSA-N |
| XLogP | 3.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|