C20H28O5S — CID 102361776
ethyl (3S)-4-methyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]-2-prop-2-enylpent-4-enoate (PubChem CID 102361776) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is ethyl (3S)-4-methyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]-2-prop-2-enylpent-4-enoate.
| Compound Name | ethyl (3S)-4-methyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]-2-prop-2-enylpent-4-enoate |
|---|---|
| PubChem CID | 102361776 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl (3S)-4-methyl-3-[2-(4-methylphenyl)sulfonyloxyethyl]-2-prop-2-enylpent-4-enoate |
| SMILES | C=CCC(C(=O)OCC)[C@H](CCOS(=O)(=O)c1ccc(C)cc1)C(=C)C |
| InChI | InChI=1S/C20H28O5S/c1-6-8-19(20(21)24-7-2)18(15(3)4)13-14-25-26(22,23)17-11-9-16(5)10-12-17/h6,9-12,18-19H,1,3,7-8,13-14H2,2,4-5H3/t18-,19?/m1/s1 |
| InChIKey | AMMMDEVSBCGONX-MRTLOADZSA-N |
| XLogP | 4.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|