C25H43NO4 — CID 102362560
(4S)-3-[(2E,4S,5S,6E)-5-hydroxy-2,4,6-trimethylhexadeca-2,6-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 102362560) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is (4S)-3-[(2E,4S,5S,6E)-5-hydroxy-2,4,6-trimethylhexadeca-2,6-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2E,4S,5S,6E)-5-hydroxy-2,4,6-trimethylhexadeca-2,6-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102362560 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | (4S)-3-[(2E,4S,5S,6E)-5-hydroxy-2,4,6-trimethylhexadeca-2,6-dienoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCC/C=C(\C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C25H43NO4/c1-7-8-9-10-11-12-13-14-15-19(4)23(27)20(5)16-21(6)24(28)26-22(18(2)3)17-30-25(26)29/h15-16,18,20,22-23,27H,7-14,17H2,1-6H3/b19-15+,21-16+/t20-,22+,23+/m0/s1 |
| InChIKey | JMFUQWUWVKAJJF-VTQIVZETSA-N |
| XLogP | 6.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|