C19H27NO3Se — CID 23256057
(4S)-3-[(2S)-2-phenylselanylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 23256057) has the molecular formula C19H27NO3Se and a molecular weight of 396.39 g/mol. Its IUPAC name is (4S)-3-[(2S)-2-phenylselanylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S)-2-phenylselanylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23256057 |
| Molecular Formula | C19H27NO3Se |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (4S)-3-[(2S)-2-phenylselanylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@H]([Se]c1ccccc1)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C19H27NO3Se/c1-4-5-7-12-17(24-15-10-8-6-9-11-15)18(21)20-16(14(2)3)13-23-19(20)22/h6,8-11,14,16-17H,4-5,7,12-13H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | FVFDJTITLKHVKA-SJORKVTESA-N |
| XLogP | 3.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|