C28H23N4O2+ — CID 102362681
(15S,19R)-17-[(1-benzyl-2H-triazol-1-ium-4-yl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102362681) has the molecular formula C28H23N4O2+ and a molecular weight of 447.52 g/mol. Its IUPAC name is (15S,19R)-17-[(1-benzyl-2H-triazol-1-ium-4-yl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-[(1-benzyl-2H-triazol-1-ium-4-yl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102362681 |
| Molecular Formula | C28H23N4O2+ |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (15S,19R)-17-[(1-benzyl-2H-triazol-1-ium-4-yl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C(=O)N1Cc1c[n+](Cc2ccccc2)[nH]n1 |
| InChI | InChI=1S/C28H22N4O2/c33-27-25-23-19-10-4-5-11-20(19)24(22-13-7-6-12-21(22)23)26(25)28(34)32(27)16-18-15-31(30-29-18)14-17-8-2-1-3-9-17/h1-13,15,23-26H,14,16H2/p+1/t23?,24?,25-,26+ |
| InChIKey | KELZNAMLONYVQP-TXFWVUOCSA-O |
| XLogP | 3.14 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|