C15H20O3 — CID 102365537
(1S,5S,8R,9R)-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecane-4,11-dione (PubChem CID 102365537) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,5S,8R,9R)-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecane-4,11-dione.
| Compound Name | (1S,5S,8R,9R)-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecane-4,11-dione |
|---|---|
| PubChem CID | 102365537 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,5S,8R,9R)-5-methyl-8-prop-1-en-2-yl-10-oxatricyclo[7.2.1.01,5]dodecane-4,11-dione |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)C(=O)CC[C@]23C[C@H]1OC3=O |
| InChI | InChI=1S/C15H20O3/c1-9(2)10-4-6-14(3)12(16)5-7-15(14)8-11(10)18-13(15)17/h10-11H,1,4-8H2,2-3H3/t10-,11-,14-,15-/m1/s1 |
| InChIKey | SFHGMCGZSACYSJ-YIKOMLBNSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|