C21H20BrNO5 — CID 102367894
(3R,4S)-3-(4-bromobenzoyl)-N-butyl-4-hydroxy-1-oxo-3H-isochromene-4-carboxamide (PubChem CID 102367894) has the molecular formula C21H20BrNO5 and a molecular weight of 446.30 g/mol. Its IUPAC name is (3R,4S)-3-(4-bromobenzoyl)-N-butyl-4-hydroxy-1-oxo-3H-isochromene-4-carboxamide.
| Compound Name | (3R,4S)-3-(4-bromobenzoyl)-N-butyl-4-hydroxy-1-oxo-3H-isochromene-4-carboxamide |
|---|---|
| PubChem CID | 102367894 |
| Molecular Formula | C21H20BrNO5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (3R,4S)-3-(4-bromobenzoyl)-N-butyl-4-hydroxy-1-oxo-3H-isochromene-4-carboxamide |
| SMILES | CCCCNC(=O)[C@]1(O)c2ccccc2C(=O)O[C@H]1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H20BrNO5/c1-2-3-12-23-20(26)21(27)16-7-5-4-6-15(16)19(25)28-18(21)17(24)13-8-10-14(22)11-9-13/h4-11,18,27H,2-3,12H2,1H3,(H,23,26)/t18-,21-/m0/s1 |
| InChIKey | FHHGHAPCGKYRCJ-RXVVDRJESA-N |
| XLogP | 2.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|