About N-butyl-1,3-dioxoisoindole-2-carboxamide
N-butyl-1,3-dioxoisoindole-2-carboxamide (PubChem CID 154333492) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is N-butyl-1,3-dioxoisoindole-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-1,3-dioxoisoindole-2-carboxamide |
| PubChem CID | 154333492 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-butyl-1,3-dioxoisoindole-2-carboxamide |
| SMILES | CCCCNC(=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14N2O3/c1-2-3-8-14-13(18)15-11(16)9-6-4-5-7-10(9)12(15)17/h4-7H,2-3,8H2,1H3,(H,14,18) |
| InChIKey | TWQXDHGLKAMUKV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1,3-dioxoisoindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1,3-dioxoisoindole-2-carboxamide?
The IUPAC name of N-butyl-1,3-dioxoisoindole-2-carboxamide (CID 154333492) is N-butyl-1,3-dioxoisoindole-2-carboxamide.
What is the SMILES notation for N-butyl-1,3-dioxoisoindole-2-carboxamide?
The canonical SMILES for N-butyl-1,3-dioxoisoindole-2-carboxamide is CCCCNC(=O)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of N-butyl-1,3-dioxoisoindole-2-carboxamide?
The InChIKey is TWQXDHGLKAMUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-2-3-8-14-13(18)15-11(16)9-6-4-5-7-10(9)12(15)17/h4-7H,2-3,8H2,1H3,(H,14,18).
What are the key properties of N-butyl-1,3-dioxoisoindole-2-carboxamide?
N-butyl-1,3-dioxoisoindole-2-carboxamide has a molecular weight of 246.27 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1,3-dioxoisoindole-2-carboxamide is sourced from PubChem (CID 154333492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).