C9H12N2O3 — CID 102248992
N-butyl-2,5-dioxopyrrole-1-carboxamide (PubChem CID 102248992) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-butyl-2,5-dioxopyrrole-1-carboxamide.
| Compound Name | N-butyl-2,5-dioxopyrrole-1-carboxamide |
|---|---|
| PubChem CID | 102248992 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-butyl-2,5-dioxopyrrole-1-carboxamide |
| SMILES | CCCCNC(=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-3-6-10-9(14)11-7(12)4-5-8(11)13/h4-5H,2-3,6H2,1H3,(H,10,14) |
| InChIKey | COTUNYHPZRMXSE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|