C15H22F2O2Si — CID 102368601
ethyl 2-benzyl-3,3-difluoro-3-trimethylsilylpropanoate (PubChem CID 102368601) has the molecular formula C15H22F2O2Si and a molecular weight of 300.42 g/mol. Its IUPAC name is ethyl 2-benzyl-3,3-difluoro-3-trimethylsilylpropanoate.
| Compound Name | ethyl 2-benzyl-3,3-difluoro-3-trimethylsilylpropanoate |
|---|---|
| PubChem CID | 102368601 |
| Molecular Formula | C15H22F2O2Si |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl 2-benzyl-3,3-difluoro-3-trimethylsilylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(F)(F)[Si](C)(C)C |
| InChI | InChI=1S/C15H22F2O2Si/c1-5-19-14(18)13(15(16,17)20(2,3)4)11-12-9-7-6-8-10-12/h6-10,13H,5,11H2,1-4H3 |
| InChIKey | PFOQSXWOJDHOCK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|