C29H30N2O5 — CID 102369830
[tert-butyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino] benzoate (PubChem CID 102369830) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is [tert-butyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino] benzoate.
| Compound Name | [tert-butyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino] benzoate |
|---|---|
| PubChem CID | 102369830 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [tert-butyl-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino] benzoate |
| SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(OC(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H30N2O5/c1-19(26(32)31(29(2,3)4)36-27(33)20-12-6-5-7-13-20)30-28(34)35-18-25-23-16-10-8-14-21(23)22-15-9-11-17-24(22)25/h5-17,19,25H,18H2,1-4H3,(H,30,34)/t19-/m0/s1 |
| InChIKey | ZGLLPDAKDBNYOJ-IBGZPJMESA-N |
| XLogP | 5.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|