C12H20O3 — CID 102370101
2-(1,3-dioxan-2-ylmethyl)cycloheptan-1-one (PubChem CID 102370101) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-ylmethyl)cycloheptan-1-one.
| Compound Name | 2-(1,3-dioxan-2-ylmethyl)cycloheptan-1-one |
|---|---|
| PubChem CID | 102370101 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-(1,3-dioxan-2-ylmethyl)cycloheptan-1-one |
| SMILES | O=C1CCCCCC1CC1OCCCO1 |
| InChI | InChI=1S/C12H20O3/c13-11-6-3-1-2-5-10(11)9-12-14-7-4-8-15-12/h10,12H,1-9H2 |
| InChIKey | OFEDYBYABKPPQC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |