C15H20N2O2 — CID 102370657
2-ethyl-1-piperidin-1-yl-3-pyridin-2-ylpropane-1,3-dione (PubChem CID 102370657) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-ethyl-1-piperidin-1-yl-3-pyridin-2-ylpropane-1,3-dione.
| Compound Name | 2-ethyl-1-piperidin-1-yl-3-pyridin-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 102370657 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-ethyl-1-piperidin-1-yl-3-pyridin-2-ylpropane-1,3-dione |
| SMILES | CCC(C(=O)c1ccccn1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-12(14(18)13-8-4-5-9-16-13)15(19)17-10-6-3-7-11-17/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3 |
| InChIKey | YDWUAHDSJGYUCV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|