C16H14ClFO3S — CID 102372374
methyl (2S)-2-(benzenesulfinyl)-3-chloro-2-fluoro-3-phenylpropanoate (PubChem CID 102372374) has the molecular formula C16H14ClFO3S and a molecular weight of 340.80 g/mol. Its IUPAC name is methyl (2S)-2-(benzenesulfinyl)-3-chloro-2-fluoro-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-(benzenesulfinyl)-3-chloro-2-fluoro-3-phenylpropanoate |
|---|---|
| PubChem CID | 102372374 |
| Molecular Formula | C16H14ClFO3S |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | methyl (2S)-2-(benzenesulfinyl)-3-chloro-2-fluoro-3-phenylpropanoate |
| SMILES | COC(=O)[C@@](F)(C(Cl)c1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14ClFO3S/c1-21-15(19)16(18,14(17)12-8-4-2-5-9-12)22(20)13-10-6-3-7-11-13/h2-11,14H,1H3/t14?,16-,22?/m1/s1 |
| InChIKey | PCARVMYXDONMSR-RPYGNYITSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|