C24H31ClO3S — CID 134876222
tert-butyl (3S)-3-[chloro-[(R)-(4-methylphenyl)sulfinyl]methyl]-3-methyl-5-phenylpentanoate (PubChem CID 134876222) has the molecular formula C24H31ClO3S and a molecular weight of 435.03 g/mol. Its IUPAC name is tert-butyl (3S)-3-[chloro-[(R)-(4-methylphenyl)sulfinyl]methyl]-3-methyl-5-phenylpentanoate.
| Compound Name | tert-butyl (3S)-3-[chloro-[(R)-(4-methylphenyl)sulfinyl]methyl]-3-methyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 134876222 |
| Molecular Formula | C24H31ClO3S |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | tert-butyl (3S)-3-[chloro-[(R)-(4-methylphenyl)sulfinyl]methyl]-3-methyl-5-phenylpentanoate |
| SMILES | Cc1ccc([S@@](=O)C(Cl)[C@@](C)(CCc2ccccc2)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31ClO3S/c1-18-11-13-20(14-12-18)29(27)22(25)24(5,17-21(26)28-23(2,3)4)16-15-19-9-7-6-8-10-19/h6-14,22H,15-17H2,1-5H3/t22?,24-,29+/m0/s1 |
| InChIKey | WUIRZXCCDYSNEJ-SOABOUKKSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|