C24H37ClO3S — CID 101249226
tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclodecyl]acetate (PubChem CID 101249226) has the molecular formula C24H37ClO3S and a molecular weight of 441.08 g/mol. Its IUPAC name is tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclodecyl]acetate.
| Compound Name | tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclodecyl]acetate |
|---|---|
| PubChem CID | 101249226 |
| Molecular Formula | C24H37ClO3S |
| Molecular Weight | 441.08 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl 2-[1-[chloro-(4-methylphenyl)sulfinylmethyl]cyclodecyl]acetate |
| SMILES | Cc1ccc(S(=O)C(Cl)C2(CC(=O)OC(C)(C)C)CCCCCCCCC2)cc1 |
| InChI | InChI=1S/C24H37ClO3S/c1-19-12-14-20(15-13-19)29(27)22(25)24(18-21(26)28-23(2,3)4)16-10-8-6-5-7-9-11-17-24/h12-15,22H,5-11,16-18H2,1-4H3 |
| InChIKey | ZSSMBQLQRKGSQQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.08 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|