C30H44O4S2 — CID 135062728
tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]undecanoate (PubChem CID 135062728) has the molecular formula C30H44O4S2 and a molecular weight of 532.81 g/mol. Its IUPAC name is tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]undecanoate.
| Compound Name | tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]undecanoate |
|---|---|
| PubChem CID | 135062728 |
| Molecular Formula | C30H44O4S2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | tert-butyl (3R)-3-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]undecanoate |
| SMILES | CCCCCCCC[C@H](CC(=O)OC(C)(C)C)C([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H44O4S2/c1-7-8-9-10-11-12-13-25(22-28(31)34-30(4,5)6)29(35(32)26-18-14-23(2)15-19-26)36(33)27-20-16-24(3)17-21-27/h14-21,25,29H,7-13,22H2,1-6H3/t25-,35+,36+/m1/s1 |
| InChIKey | BAFJHLXGCGVVMR-YZRVVHFXSA-N |
| XLogP | 7.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|